C18H29BrN6O — CID 58853443
[(1R,2S)-2-[[3-bromo-7-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclohexyl]methanol (PubChem CID 58853443) has the molecular formula C18H29BrN6O and a molecular weight of 425.38 g/mol. Its IUPAC name is [(1R,2S)-2-[[3-bromo-7-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclohexyl]methanol.
| Compound Name | [(1R,2S)-2-[[3-bromo-7-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 58853443 |
| Molecular Formula | C18H29BrN6O |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [(1R,2S)-2-[[3-bromo-7-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]cyclohexyl]methanol |
| SMILES | CN(C)CCCNc1cc(N[C@H]2CCCC[C@H]2CO)nc2c(Br)cnn12 |
| InChI | InChI=1S/C18H29BrN6O/c1-24(2)9-5-8-20-17-10-16(23-18-14(19)11-21-25(17)18)22-15-7-4-3-6-13(15)12-26/h10-11,13,15,20,26H,3-9,12H2,1-2H3,(H,22,23)/t13-,15-/m0/s1 |
| InChIKey | WRRRJWIMAZCVKJ-ZFWWWQNUSA-N |
| XLogP | 2.82 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|