About 3-methyliminopropyl carbamate
3-methyliminopropyl carbamate (PubChem CID 142872517) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 3-methyliminopropyl carbamate.
Molecular Properties
| Compound Name | 3-methyliminopropyl carbamate |
| PubChem CID | 142872517 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 3-methyliminopropyl carbamate |
| SMILES | C/N=C/CCOC(N)=O |
| InChI | InChI=1S/C5H10N2O2/c1-7-3-2-4-9-5(6)8/h3H,2,4H2,1H3,(H2,6,8)/b7-3+ |
| InChIKey | QJNGIPHZPDUENV-XVNBXDOJSA-N |
| XLogP | 0.17 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyliminopropyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyliminopropyl carbamate?
The IUPAC name of 3-methyliminopropyl carbamate (CID 142872517) is 3-methyliminopropyl carbamate.
What is the SMILES notation for 3-methyliminopropyl carbamate?
The canonical SMILES for 3-methyliminopropyl carbamate is C/N=C/CCOC(N)=O.
What is the InChIKey of 3-methyliminopropyl carbamate?
The InChIKey is QJNGIPHZPDUENV-XVNBXDOJSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-7-3-2-4-9-5(6)8/h3H,2,4H2,1H3,(H2,6,8)/b7-3+.
What are the key properties of 3-methyliminopropyl carbamate?
3-methyliminopropyl carbamate has a molecular weight of 130.15 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyliminopropyl carbamate is sourced from PubChem (CID 142872517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).