C30H37N7O — CID 142873267
4-[[(2-amino-2-iminoethyl)-(1H-benzimidazol-2-ylmethyl)amino]methyl]-N-[4-[[ethyl(propyl)amino]methyl]phenyl]benzamide (PubChem CID 142873267) has the molecular formula C30H37N7O and a molecular weight of 511.67 g/mol. Its IUPAC name is 4-[[(2-amino-2-iminoethyl)-(1H-benzimidazol-2-ylmethyl)amino]methyl]-N-[4-[[ethyl(propyl)amino]methyl]phenyl]benzamide.
| Compound Name | 4-[[(2-amino-2-iminoethyl)-(1H-benzimidazol-2-ylmethyl)amino]methyl]-N-[4-[[ethyl(propyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 142873267 |
| Molecular Formula | C30H37N7O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 4-[[(2-amino-2-iminoethyl)-(1H-benzimidazol-2-ylmethyl)amino]methyl]-N-[4-[[ethyl(propyl)amino]methyl]phenyl]benzamide |
| SMILES | [H]/N=C(\N)CN(Cc1ccc(C(=O)Nc2ccc(CN(CC)CCC)cc2)cc1)Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C30H37N7O/c1-3-17-36(4-2)18-23-11-15-25(16-12-23)33-30(38)24-13-9-22(10-14-24)19-37(20-28(31)32)21-29-34-26-7-5-6-8-27(26)35-29/h5-16H,3-4,17-21H2,1-2H3,(H3,31,32)(H,33,38)(H,34,35) |
| InChIKey | NXETWMVRYUXVAL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|