C24H32N4O — CID 16759221
4-(1H-benzimidazol-2-ylmethyl)-N-[5-(diethylamino)pentan-2-yl]benzamide (PubChem CID 16759221) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylmethyl)-N-[5-(diethylamino)pentan-2-yl]benzamide.
| Compound Name | 4-(1H-benzimidazol-2-ylmethyl)-N-[5-(diethylamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 16759221 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylmethyl)-N-[5-(diethylamino)pentan-2-yl]benzamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1ccc(Cc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H32N4O/c1-4-28(5-2)16-8-9-18(3)25-24(29)20-14-12-19(13-15-20)17-23-26-21-10-6-7-11-22(21)27-23/h6-7,10-15,18H,4-5,8-9,16-17H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | ISDYYOFUDCLEPC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |