C34H34O12 — CID 142873822
2-(3,4-dihydroxyphenyl)-8-[2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]propan-2-yl]-4-methyl-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 142873822) has the molecular formula C34H34O12 and a molecular weight of 634.63 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-8-[2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]propan-2-yl]-4-methyl-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | 2-(3,4-dihydroxyphenyl)-8-[2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]propan-2-yl]-4-methyl-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 142873822 |
| Molecular Formula | C34H34O12 |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-8-[2-[2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]propan-2-yl]-4-methyl-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | CC1c2c(O)cc(O)c(C(C)(C)C3c4c(O)cc(O)cc4OC(c4ccc(O)c(O)c4)C3O)c2OC(c2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C34H34O12/c1-13-25-22(41)12-23(42)27(33(25)46-31(29(13)43)14-4-6-17(36)19(38)8-14)34(2,3)28-26-21(40)10-16(35)11-24(26)45-32(30(28)44)15-5-7-18(37)20(39)9-15/h4-13,28-32,35-44H,1-3H3 |
| InChIKey | NKOIOSDXNZEZOV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|