C10H18N4O — CID 142873886
3-[(4-ethylpyrimidin-2-yl)methoxy]propane-1,2-diamine (PubChem CID 142873886) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-[(4-ethylpyrimidin-2-yl)methoxy]propane-1,2-diamine.
| Compound Name | 3-[(4-ethylpyrimidin-2-yl)methoxy]propane-1,2-diamine |
|---|---|
| PubChem CID | 142873886 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-[(4-ethylpyrimidin-2-yl)methoxy]propane-1,2-diamine |
| SMILES | CCc1ccnc(COCC(N)CN)n1 |
| InChI | InChI=1S/C10H18N4O/c1-2-9-3-4-13-10(14-9)7-15-6-8(12)5-11/h3-4,8H,2,5-7,11-12H2,1H3 |
| InChIKey | SPYIRJGCGHWPFV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |