C10H17N3O — CID 142873883
3-[(4-methyl-2-pyridinyl)methoxy]propane-1,2-diamine (PubChem CID 142873883) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-[(4-methyl-2-pyridinyl)methoxy]propane-1,2-diamine.
| Compound Name | 3-[(4-methyl-2-pyridinyl)methoxy]propane-1,2-diamine |
|---|---|
| PubChem CID | 142873883 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-[(4-methyl-2-pyridinyl)methoxy]propane-1,2-diamine |
| SMILES | Cc1ccnc(COCC(N)CN)c1 |
| InChI | InChI=1S/C10H17N3O/c1-8-2-3-13-10(4-8)7-14-6-9(12)5-11/h2-4,9H,5-7,11-12H2,1H3 |
| InChIKey | WJAHLWHLRRAHTO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |