C35H43F2N3O4 — CID 142874188
benzyl 4-[[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]methyl]-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 142874188) has the molecular formula C35H43F2N3O4 and a molecular weight of 607.74 g/mol. Its IUPAC name is benzyl 4-[[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]methyl]-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 4-[[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]methyl]-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 142874188 |
| Molecular Formula | C35H43F2N3O4 |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | benzyl 4-[[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]methyl]-6-(2,2-dimethylpropyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCC1CCN(C(=O)OCc2ccccc2)c2ccc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C35H43F2N3O4/c1-23(41)39-31(17-26-14-28(36)18-29(37)15-26)33(42)21-38-20-27-12-13-40(34(43)44-22-24-8-6-5-7-9-24)32-11-10-25(16-30(27)32)19-35(2,3)4/h5-11,14-16,18,27,31,33,38,42H,12-13,17,19-22H2,1-4H3,(H,39,41)/t27?,31-,33+/m0/s1 |
| InChIKey | KZMREBYLGGZUNN-MYUNVGSTSA-N |
| XLogP | 5.88 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |