About 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine
1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine (PubChem CID 142875509) has the molecular formula C19H26ClNO2
and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine.
Molecular Properties
| Compound Name | 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine |
| PubChem CID | 142875509 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine |
| SMILES | COOCCN.Cc1ccc(CCc2cc(C)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl.C3H9NO2/c1-12-3-5-14(6-4-12)7-8-15-9-13(2)10-16(17)11-15;1-5-6-3-2-4/h3-6,9-11H,7-8H2,1-2H3;2-4H2,1H3 |
| InChIKey | FYKIXDPOPYTMHR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine?
The IUPAC name of 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine (CID 142875509) is 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine.
What is the SMILES notation for 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine?
The canonical SMILES for 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine is COOCCN.Cc1ccc(CCc2cc(C)cc(Cl)c2)cc1.
What is the InChIKey of 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine?
The InChIKey is FYKIXDPOPYTMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl.C3H9NO2/c1-12-3-5-14(6-4-12)7-8-15-9-13(2)10-16(17)11-15;1-5-6-3-2-4/h3-6,9-11H,7-8H2,1-2H3;2-4H2,1H3.
What are the key properties of 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine?
1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine has a molecular weight of 335.88 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-methyl-5-[2-(4-methylphenyl)ethyl]benzene;2-methylperoxyethanamine is sourced from PubChem (CID 142875509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).