C19H33FO5 — CID 142875818
butan-1-ol;2-fluoro-1-[2-[3-(2-methoxyethoxy)propoxy]ethoxy]-4-methylbenzene (PubChem CID 142875818) has the molecular formula C19H33FO5 and a molecular weight of 360.47 g/mol. Its IUPAC name is butan-1-ol;2-fluoro-1-[2-[3-(2-methoxyethoxy)propoxy]ethoxy]-4-methylbenzene.
| Compound Name | butan-1-ol;2-fluoro-1-[2-[3-(2-methoxyethoxy)propoxy]ethoxy]-4-methylbenzene |
|---|---|
| PubChem CID | 142875818 |
| Molecular Formula | C19H33FO5 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | butan-1-ol;2-fluoro-1-[2-[3-(2-methoxyethoxy)propoxy]ethoxy]-4-methylbenzene |
| SMILES | CCCCO.COCCOCCCOCCOc1ccc(C)cc1F |
| InChI | InChI=1S/C15H23FO4.C4H10O/c1-13-4-5-15(14(16)12-13)20-11-10-19-7-3-6-18-9-8-17-2;1-2-3-4-5/h4-5,12H,3,6-11H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | GYQMTJJHSKILMN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|