About N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide
N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide (PubChem CID 142875838) has the molecular formula C15H28N4
and a molecular weight of 264.42 g/mol. Its IUPAC name is N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide.
Molecular Properties
| Compound Name | N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide |
| PubChem CID | 142875838 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide |
| SMILES | C/C=C(\CC)N/C(C)=N\C(N)=N\C1CCCCCC1 |
| InChI | InChI=1S/C15H28N4/c1-4-13(5-2)17-12(3)18-15(16)19-14-10-8-6-7-9-11-14/h4,14H,5-11H2,1-3H3,(H3,16,17,18,19)/b13-4+ |
| InChIKey | QJTATWCIFDNSIZ-YIXHJXPBSA-N |
| XLogP | 3.35 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide?
The IUPAC name of N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide (CID 142875838) is N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide.
What is the SMILES notation for N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide?
The canonical SMILES for N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide is C/C=C(\CC)N/C(C)=N\C(N)=N\C1CCCCCC1.
What is the InChIKey of N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide?
The InChIKey is QJTATWCIFDNSIZ-YIXHJXPBSA-N. The full InChI is InChI=1S/C15H28N4/c1-4-13(5-2)17-12(3)18-15(16)19-14-10-8-6-7-9-11-14/h4,14H,5-11H2,1-3H3,(H3,16,17,18,19)/b13-4+.
What are the key properties of N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide?
N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide has a molecular weight of 264.42 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(N'-cycloheptylcarbamimidoyl)-N-[(E)-pent-2-en-3-yl]ethanimidamide is sourced from PubChem (CID 142875838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).