C17H32N2 — CID 154121257
N-dodecyl-5-methyl-1,3-dihydropyrrol-2-imine (PubChem CID 154121257) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-dodecyl-5-methyl-1,3-dihydropyrrol-2-imine.
| Compound Name | N-dodecyl-5-methyl-1,3-dihydropyrrol-2-imine |
|---|---|
| PubChem CID | 154121257 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-dodecyl-5-methyl-1,3-dihydropyrrol-2-imine |
| SMILES | CCCCCCCCCCCC/N=C1\CC=C(C)N1 |
| InChI | InChI=1S/C17H32N2/c1-3-4-5-6-7-8-9-10-11-12-15-18-17-14-13-16(2)19-17/h13H,3-12,14-15H2,1-2H3,(H,18,19) |
| InChIKey | DKPONTSSLJMVTE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|