C24H24BrN5S — CID 142876582
3-bromo-N-[4-(cyclohexylamino)sulfanylphenyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 142876582) has the molecular formula C24H24BrN5S and a molecular weight of 494.46 g/mol. Its IUPAC name is 3-bromo-N-[4-(cyclohexylamino)sulfanylphenyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-N-[4-(cyclohexylamino)sulfanylphenyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 142876582 |
| Molecular Formula | C24H24BrN5S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 3-bromo-N-[4-(cyclohexylamino)sulfanylphenyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Brc1cnn2c(Nc3ccc(SNC4CCCCC4)cc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C24H24BrN5S/c25-21-16-26-30-23(15-22(28-24(21)30)17-7-3-1-4-8-17)27-18-11-13-20(14-12-18)31-29-19-9-5-2-6-10-19/h1,3-4,7-8,11-16,19,27,29H,2,5-6,9-10H2 |
| InChIKey | SIBPGOZUIVQARL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|