C22H23BrN6S — CID 142876629
N-[4-[(3-bromo-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]sulfanyl-N',N'-dimethylethane-1,2-diamine (PubChem CID 142876629) has the molecular formula C22H23BrN6S and a molecular weight of 483.44 g/mol. Its IUPAC name is N-[4-[(3-bromo-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]sulfanyl-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[4-[(3-bromo-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]sulfanyl-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142876629 |
| Molecular Formula | C22H23BrN6S |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N-[4-[(3-bromo-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl)amino]phenyl]sulfanyl-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNSc1ccc(Nc2cc(-c3ccccc3)nc3c(Br)cnn23)cc1 |
| InChI | InChI=1S/C22H23BrN6S/c1-28(2)13-12-25-30-18-10-8-17(9-11-18)26-21-14-20(16-6-4-3-5-7-16)27-22-19(23)15-24-29(21)22/h3-11,14-15,25-26H,12-13H2,1-2H3 |
| InChIKey | IRSOMSMUXWCITN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|