C22H24BrN6O2+ — CID 21067197
3-bromo-N-[[6-[2-(dimethylamino)ethoxy]-1-hydroxypyridin-1-ium-3-yl]methyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 21067197) has the molecular formula C22H24BrN6O2+ and a molecular weight of 484.38 g/mol. Its IUPAC name is 3-bromo-N-[[6-[2-(dimethylamino)ethoxy]-1-hydroxypyridin-1-ium-3-yl]methyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-N-[[6-[2-(dimethylamino)ethoxy]-1-hydroxypyridin-1-ium-3-yl]methyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 21067197 |
| Molecular Formula | C22H24BrN6O2+ |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-bromo-N-[[6-[2-(dimethylamino)ethoxy]-1-hydroxypyridin-1-ium-3-yl]methyl]-5-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CN(C)CCOc1ccc(CNc2cc(-c3ccccc3)nc3c(Br)cnn23)c[n+]1O |
| InChI | InChI=1S/C22H24BrN6O2/c1-27(2)10-11-31-21-9-8-16(15-28(21)30)13-24-20-12-19(17-6-4-3-5-7-17)26-22-18(23)14-25-29(20)22/h3-9,12,14-15,24,30H,10-11,13H2,1-2H3/q+1 |
| InChIKey | QCGJELIFDDPVAQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|