C20H19BN6 — CID 89057854
CID 89057854 (PubChem CID 89057854) has the molecular formula C20H19BN6 and a molecular weight of 354.23 g/mol.
| Compound Name | CID 89057854 |
|---|---|
| PubChem CID | 89057854 |
| Molecular Formula | C20H19BN6 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3ccc(N(C)C)nc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C20H19BN6/c1-26(2)18-9-8-14(11-22-18)12-23-19-10-17(15-6-4-3-5-7-15)25-20-16(21)13-24-27(19)20/h3-11,13,23H,12H2,1-2H3 |
| InChIKey | IDFWWKVEARZTNV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|