C13H19N3 — CID 142876585
N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine (PubChem CID 142876585) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine.
| Compound Name | N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 142876585 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-[(1Z)-1-cyclohexylbuta-1,3-dienyl]-1H-pyrazol-5-amine |
| SMILES | C=C/C=C(\Nc1ccn[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C13H19N3/c1-2-6-12(11-7-4-3-5-8-11)15-13-9-10-14-16-13/h2,6,9-11H,1,3-5,7-8H2,(H2,14,15,16)/b12-6- |
| InChIKey | ATBATUIFIKQPCW-SDQBBNPISA-N |
| XLogP | 3.47 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|