C25H21N5 — CID 142876884
3-benzyl-6-phenyl-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 142876884) has the molecular formula C25H21N5 and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-benzyl-6-phenyl-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-benzyl-6-phenyl-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 142876884 |
| Molecular Formula | C25H21N5 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-benzyl-6-phenyl-N-(pyridin-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | c1ccc(Cc2cnc3c(NCc4cccnc4)nc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C25H21N5/c1-3-8-19(9-4-1)14-22-17-28-25-24(27-16-20-10-7-13-26-15-20)29-23(18-30(22)25)21-11-5-2-6-12-21/h1-13,15,17-18H,14,16H2,(H,27,29) |
| InChIKey | QUONGSULAVTEID-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |