C14H12F3IN4 — CID 167648686
N-benzyl-3-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-8-amine;molecular hydrogen (PubChem CID 167648686) has the molecular formula C14H12F3IN4 and a molecular weight of 420.18 g/mol. Its IUPAC name is N-benzyl-3-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-8-amine;molecular hydrogen.
| Compound Name | N-benzyl-3-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-8-amine;molecular hydrogen |
|---|---|
| PubChem CID | 167648686 |
| Molecular Formula | C14H12F3IN4 |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | N-benzyl-3-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyrazin-8-amine;molecular hydrogen |
| SMILES | FC(F)(F)c1cn2c(I)cnc2c(NCc2ccccc2)n1.[H][H] |
| InChI | InChI=1S/C14H10F3IN4.H2/c15-14(16,17)10-8-22-11(18)7-20-13(22)12(21-10)19-6-9-4-2-1-3-5-9;/h1-5,7-8H,6H2,(H,19,21);1H |
| InChIKey | QGHYRNQAVWKFDF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|