C16H14N6O2 — CID 142877734
N-[4-(ethylamino)-7-nitrosoquinazolin-2-yl]pyridine-3-carboxamide (PubChem CID 142877734) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[4-(ethylamino)-7-nitrosoquinazolin-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[4-(ethylamino)-7-nitrosoquinazolin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142877734 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[4-(ethylamino)-7-nitrosoquinazolin-2-yl]pyridine-3-carboxamide |
| SMILES | CCNc1nc(NC(=O)c2cccnc2)nc2cc(N=O)ccc12 |
| InChI | InChI=1S/C16H14N6O2/c1-2-18-14-12-6-5-11(22-24)8-13(12)19-16(20-14)21-15(23)10-4-3-7-17-9-10/h3-9H,2H2,1H3,(H2,18,19,20,21,23) |
| InChIKey | MSVNORVGJOVLJT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |