C19H22N4OS — CID 142878764
2-(2-amino-5-thiophen-3-ylphenyl)-N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-iminoacetamide (PubChem CID 142878764) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-(2-amino-5-thiophen-3-ylphenyl)-N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-iminoacetamide.
| Compound Name | 2-(2-amino-5-thiophen-3-ylphenyl)-N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-iminoacetamide |
|---|---|
| PubChem CID | 142878764 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(2-amino-5-thiophen-3-ylphenyl)-N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-iminoacetamide |
| SMILES | [H]/N=C(/C(=O)N[C@@H]1CN2CCC1CC2)c1cc(-c2ccsc2)ccc1N |
| InChI | InChI=1S/C19H22N4OS/c20-16-2-1-13(14-5-8-25-11-14)9-15(16)18(21)19(24)22-17-10-23-6-3-12(17)4-7-23/h1-2,5,8-9,11-12,17,21H,3-4,6-7,10,20H2,(H,22,24)/b21-18+/t17-/m1/s1 |
| InChIKey | ZVAHORXNQKDMET-STIUTOJCSA-N |
| XLogP | 2.58 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|