C20H21N3OS — CID 58416546
2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-3-yl-1H-indazol-3-yl)ethanone (PubChem CID 58416546) has the molecular formula C20H21N3OS and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-3-yl-1H-indazol-3-yl)ethanone.
| Compound Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-3-yl-1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 58416546 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-3-yl-1H-indazol-3-yl)ethanone |
| SMILES | O=C(C[C@H]1CN2CCC1CC2)c1n[nH]c2cc(-c3ccsc3)ccc12 |
| InChI | InChI=1S/C20H21N3OS/c24-19(10-16-11-23-6-3-13(16)4-7-23)20-17-2-1-14(9-18(17)21-22-20)15-5-8-25-12-15/h1-2,5,8-9,12-13,16H,3-4,6-7,10-11H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | WMHOBGUVOUZQBV-INIZCTEOSA-N |
| XLogP | 4.21 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |