C21H24N4O3S — CID 161315198
2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-[5-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]ethanone;formic acid (PubChem CID 161315198) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-[5-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]ethanone;formic acid.
| Compound Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-[5-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 161315198 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-[5-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]ethanone;formic acid |
| SMILES | Cc1csc(-c2ccc3[nH]nc(C(=O)C[C@H]4CN5CCC4CC5)c3c2)n1.O=CO |
| InChI | InChI=1S/C20H22N4OS.CH2O2/c1-12-11-26-20(21-12)14-2-3-17-16(8-14)19(23-22-17)18(25)9-15-10-24-6-4-13(15)5-7-24;2-1-3/h2-3,8,11,13,15H,4-7,9-10H2,1H3,(H,22,23);1H,(H,2,3)/t15-;/m0./s1 |
| InChIKey | VJKCSTSQQYYQEA-RSAXXLAASA-N |
| XLogP | 3.61 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|