C23H25N3O3 — CID 123390295
2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-phenyl-1H-indazol-3-yl)ethanone;formic acid (PubChem CID 123390295) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-phenyl-1H-indazol-3-yl)ethanone;formic acid.
| Compound Name | 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-phenyl-1H-indazol-3-yl)ethanone;formic acid |
|---|---|
| PubChem CID | 123390295 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-phenyl-1H-indazol-3-yl)ethanone;formic acid |
| SMILES | O=C(C[C@@H]1CN2CCC1CC2)c1n[nH]c2cc(-c3ccccc3)ccc12.O=CO |
| InChI | InChI=1S/C22H23N3O.CH2O2/c26-21(13-18-14-25-10-8-16(18)9-11-25)22-19-7-6-17(12-20(19)23-24-22)15-4-2-1-3-5-15;2-1-3/h1-7,12,16,18H,8-11,13-14H2,(H,23,24);1H,(H,2,3)/t18-;/m1./s1 |
| InChIKey | DSTLOTZIULNOQB-GMUIIQOCSA-N |
| XLogP | 3.85 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|