C19H21N3O3 — CID 158359078
2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-ethynyl-1H-indazol-3-yl)ethanone;formic acid (PubChem CID 158359078) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-ethynyl-1H-indazol-3-yl)ethanone;formic acid.
| Compound Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-ethynyl-1H-indazol-3-yl)ethanone;formic acid |
|---|---|
| PubChem CID | 158359078 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-ethynyl-1H-indazol-3-yl)ethanone;formic acid |
| SMILES | C#Cc1ccc2[nH]nc(C(=O)C[C@H]3CN4CCC3CC4)c2c1.O=CO |
| InChI | InChI=1S/C18H19N3O.CH2O2/c1-2-12-3-4-16-15(9-12)18(20-19-16)17(22)10-14-11-21-7-5-13(14)6-8-21;2-1-3/h1,3-4,9,13-14H,5-8,10-11H2,(H,19,20);1H,(H,2,3)/t14-;/m0./s1 |
| InChIKey | GTGBLKOMIZAXSG-UQKRIMTDSA-N |
| XLogP | 2.16 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|