C21H23N3O3S — CID 123838269
2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-2-yl-1H-indazol-3-yl)ethanone;formic acid (PubChem CID 123838269) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-2-yl-1H-indazol-3-yl)ethanone;formic acid.
| Compound Name | 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-2-yl-1H-indazol-3-yl)ethanone;formic acid |
|---|---|
| PubChem CID | 123838269 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-thiophen-2-yl-1H-indazol-3-yl)ethanone;formic acid |
| SMILES | O=C(C[C@@H]1CN2CCC1CC2)c1n[nH]c2cc(-c3cccs3)ccc12.O=CO |
| InChI | InChI=1S/C20H21N3OS.CH2O2/c24-18(11-15-12-23-7-5-13(15)6-8-23)20-16-4-3-14(10-17(16)21-22-20)19-2-1-9-25-19;2-1-3/h1-4,9-10,13,15H,5-8,11-12H2,(H,21,22);1H,(H,2,3)/t15-;/m1./s1 |
| InChIKey | BQBXOTONFLPCNU-XFULWGLBSA-N |
| XLogP | 3.91 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|