C16H20ClN3O — CID 159366954
2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(1H-indazol-3-yl)ethanone;hydrochloride (PubChem CID 159366954) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(1H-indazol-3-yl)ethanone;hydrochloride.
| Compound Name | 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(1H-indazol-3-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 159366954 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1-(1H-indazol-3-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(C[C@@H]1CN2CCC1CC2)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C16H19N3O.ClH/c20-15(9-12-10-19-7-5-11(12)6-8-19)16-13-3-1-2-4-14(13)17-18-16;/h1-4,11-12H,5-10H2,(H,17,18);1H/t12-;/m1./s1 |
| InChIKey | HFLZAMXWSUKWTG-UTONKHPSSA-N |
| XLogP | 2.90 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |