C21H25N3O — CID 58578129
2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-pent-1-ynyl-1H-indazol-3-yl)ethanone (PubChem CID 58578129) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-pent-1-ynyl-1H-indazol-3-yl)ethanone.
| Compound Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-pent-1-ynyl-1H-indazol-3-yl)ethanone |
|---|---|
| PubChem CID | 58578129 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(6-pent-1-ynyl-1H-indazol-3-yl)ethanone |
| SMILES | CCCC#Cc1ccc2c(C(=O)C[C@H]3CN4CCC3CC4)n[nH]c2c1 |
| InChI | InChI=1S/C21H25N3O/c1-2-3-4-5-15-6-7-18-19(12-15)22-23-21(18)20(25)13-17-14-24-10-8-16(17)9-11-24/h6-7,12,16-17H,2-3,8-11,13-14H2,1H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | OBVFFBVHTSFEIW-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|