C17H20ClN3O3 — CID 158851396
2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-chloro-1H-indazol-3-yl)ethanone;formic acid (PubChem CID 158851396) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-chloro-1H-indazol-3-yl)ethanone;formic acid.
| Compound Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-chloro-1H-indazol-3-yl)ethanone;formic acid |
|---|---|
| PubChem CID | 158851396 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-(5-chloro-1H-indazol-3-yl)ethanone;formic acid |
| SMILES | O=C(C[C@H]1CN2CCC1CC2)c1n[nH]c2ccc(Cl)cc12.O=CO |
| InChI | InChI=1S/C16H18ClN3O.CH2O2/c17-12-1-2-14-13(8-12)16(19-18-14)15(21)7-11-9-20-5-3-10(11)4-6-20;2-1-3/h1-2,8,10-11H,3-7,9H2,(H,18,19);1H,(H,2,3)/t11-;/m0./s1 |
| InChIKey | IZMMFYRYHDXHGP-MERQFXBCSA-N |
| XLogP | 2.83 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|