C20H23N5O3S — CID 11618495
1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]methanone;formic acid (PubChem CID 11618495) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]methanone;formic acid.
| Compound Name | 1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 11618495 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(4-methyl-1,3-thiazol-2-yl)-1H-indazol-3-yl]methanone;formic acid |
| SMILES | Cc1csc(-c2ccc3c(C(=O)N4CCN5CCC4CC5)n[nH]c3c2)n1.O=CO |
| InChI | InChI=1S/C19H21N5OS.CH2O2/c1-12-11-26-18(20-12)13-2-3-15-16(10-13)21-22-17(15)19(25)24-9-8-23-6-4-14(24)5-7-23;2-1-3/h2-3,10-11,14H,4-9H2,1H3,(H,21,22);1H,(H,2,3) |
| InChIKey | QXKLPPHPQDZAEI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|