C20H22N4O4S — CID 158255180
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] formate;5-(4-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylic acid (PubChem CID 158255180) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] formate;5-(4-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylic acid.
| Compound Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] formate;5-(4-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 158255180 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] formate;5-(4-methyl-1,3-thiazol-2-yl)-1H-indazole-3-carboxylic acid |
| SMILES | Cc1csc(-c2ccc3[nH]nc(C(=O)O)c3c2)n1.O=CO[C@@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C12H9N3O2S.C8H13NO2/c1-6-5-18-11(13-6)7-2-3-9-8(4-7)10(12(16)17)15-14-9;10-6-11-8-5-9-3-1-7(8)2-4-9/h2-5H,1H3,(H,14,15)(H,16,17);6-8H,1-5H2/t;8-/m.1/s1 |
| InChIKey | GHETXEQYFFWAHZ-NIFFTEIASA-N |
| XLogP | 2.95 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|