C20H29N5O3 — CID 158382484
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5-(diethylamino)-1H-indazole-3-carboxamide;formic acid (PubChem CID 158382484) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5-(diethylamino)-1H-indazole-3-carboxamide;formic acid.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5-(diethylamino)-1H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 158382484 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5-(diethylamino)-1H-indazole-3-carboxamide;formic acid |
| SMILES | CCN(CC)c1ccc2[nH]nc(C(=O)N[C@@H]3CN4CCC3CC4)c2c1.O=CO |
| InChI | InChI=1S/C19H27N5O.CH2O2/c1-3-24(4-2)14-5-6-16-15(11-14)18(22-21-16)19(25)20-17-12-23-9-7-13(17)8-10-23;2-1-3/h5-6,11,13,17H,3-4,7-10,12H2,1-2H3,(H,20,25)(H,21,22);1H,(H,2,3)/t17-;/m1./s1 |
| InChIKey | GVYVJSSLSWWCRV-UNTBIKODSA-N |
| XLogP | 1.93 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|