C16H19BrN4O4 — CID 135589797
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-bromo-4-hydroxy-1H-indazole-3-carboxamide;formic acid (PubChem CID 135589797) has the molecular formula C16H19BrN4O4 and a molecular weight of 411.26 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-bromo-4-hydroxy-1H-indazole-3-carboxamide;formic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-bromo-4-hydroxy-1H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 135589797 |
| Molecular Formula | C16H19BrN4O4 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-bromo-4-hydroxy-1H-indazole-3-carboxamide;formic acid |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1n[nH]c2ccc(Br)c(O)c12.O=CO |
| InChI | InChI=1S/C15H17BrN4O2.CH2O2/c16-9-1-2-10-12(14(9)21)13(19-18-10)15(22)17-11-7-20-5-3-8(11)4-6-20;2-1-3/h1-2,8,11,21H,3-7H2,(H,17,22)(H,18,19);1H,(H,2,3)/t11-;/m0./s1 |
| InChIKey | FXNLALWGHYZIQX-MERQFXBCSA-N |
| XLogP | 1.56 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|