C16H18Br2N4O4 — CID 135589796
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,7-dibromo-4-hydroxy-2H-indazole-3-carboxamide;formic acid (PubChem CID 135589796) has the molecular formula C16H18Br2N4O4 and a molecular weight of 490.15 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,7-dibromo-4-hydroxy-2H-indazole-3-carboxamide;formic acid.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,7-dibromo-4-hydroxy-2H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 135589796 |
| Molecular Formula | C16H18Br2N4O4 |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-5,7-dibromo-4-hydroxy-2H-indazole-3-carboxamide;formic acid |
| SMILES | O=C(N[C@@H]1CN2CCC1CC2)c1[nH]nc2c(Br)cc(Br)c(O)c12.O=CO |
| InChI | InChI=1S/C15H16Br2N4O2.CH2O2/c16-8-5-9(17)14(22)11-12(8)19-20-13(11)15(23)18-10-6-21-3-1-7(10)2-4-21;2-1-3/h5,7,10,22H,1-4,6H2,(H,18,23)(H,19,20);1H,(H,2,3)/t10-;/m1./s1 |
| InChIKey | TZFVQWIIOQYZRJ-HNCPQSOCSA-N |
| XLogP | 2.32 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|