C20H28N4O4 — CID 159185497
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(3-methoxypropyl)-1H-indazole-3-carboxamide;formic acid (PubChem CID 159185497) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(3-methoxypropyl)-1H-indazole-3-carboxamide;formic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(3-methoxypropyl)-1H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 159185497 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(3-methoxypropyl)-1H-indazole-3-carboxamide;formic acid |
| SMILES | COCCCc1ccc2[nH]nc(C(=O)N[C@H]3CN4CCC3CC4)c2c1.O=CO |
| InChI | InChI=1S/C19H26N4O2.CH2O2/c1-25-10-2-3-13-4-5-16-15(11-13)18(22-21-16)19(24)20-17-12-23-8-6-14(17)7-9-23;2-1-3/h4-5,11,14,17H,2-3,6-10,12H2,1H3,(H,20,24)(H,21,22);1H,(H,2,3)/t17-;/m0./s1 |
| InChIKey | KNKYVBIJCHOSRV-LMOVPXPDSA-N |
| XLogP | 1.67 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|