C15H19N5O2 — CID 59293315
[3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1H-indazol-5-yl]-oxidoazanium (PubChem CID 59293315) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is [3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1H-indazol-5-yl]-oxidoazanium.
| Compound Name | [3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1H-indazol-5-yl]-oxidoazanium |
|---|---|
| PubChem CID | 59293315 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | [3-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-1H-indazol-5-yl]-oxidoazanium |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1n[nH]c2ccc([NH2+][O-])cc12 |
| InChI | InChI=1S/C15H19N5O2/c21-15(16-13-8-20-5-3-9(13)4-6-20)14-11-7-10(19-22)1-2-12(11)17-18-14/h1-2,7,9,13H,3-6,8,19H2,(H,16,21)(H,17,18)/t13-/m0/s1 |
| InChIKey | TZARQBRYFBQRLX-ZDUSSCGKSA-N |
| XLogP | 0.08 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|