C23H25N4O3S+ — CID 142879965
[4-[(E)-3-amino-4-(3,5-dicyanophenoxy)-5-iminohept-3-enoxy]phenyl]-methoxy-methylsulfanium (PubChem CID 142879965) has the molecular formula C23H25N4O3S+ and a molecular weight of 437.55 g/mol. Its IUPAC name is [4-[(E)-3-amino-4-(3,5-dicyanophenoxy)-5-iminohept-3-enoxy]phenyl]-methoxy-methylsulfanium.
| Compound Name | [4-[(E)-3-amino-4-(3,5-dicyanophenoxy)-5-iminohept-3-enoxy]phenyl]-methoxy-methylsulfanium |
|---|---|
| PubChem CID | 142879965 |
| Molecular Formula | C23H25N4O3S+ |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [4-[(E)-3-amino-4-(3,5-dicyanophenoxy)-5-iminohept-3-enoxy]phenyl]-methoxy-methylsulfanium |
| SMILES | [H]/N=C(CC)/C(Oc1cc(C#N)cc(C#N)c1)=C(\N)CCOc1ccc([S+](C)OC)cc1 |
| InChI | InChI=1S/C23H25N4O3S/c1-4-21(26)23(30-19-12-16(14-24)11-17(13-19)15-25)22(27)9-10-29-18-5-7-20(8-6-18)31(3)28-2/h5-8,11-13,26H,4,9-10,27H2,1-3H3/q+1/b23-22+,26-21+ |
| InChIKey | WTOQZQQTCDUHLJ-CNYCFYRKSA-N |
| XLogP | 4.05 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|