C18H17FNO6+ — CID 142880322
[4-(4-fluoro-2-nitrophenyl)-2-methoxycarbonyl-3-phenylbutanoyl]oxidanium (PubChem CID 142880322) has the molecular formula C18H17FNO6+ and a molecular weight of 362.33 g/mol. Its IUPAC name is [4-(4-fluoro-2-nitrophenyl)-2-methoxycarbonyl-3-phenylbutanoyl]oxidanium.
| Compound Name | [4-(4-fluoro-2-nitrophenyl)-2-methoxycarbonyl-3-phenylbutanoyl]oxidanium |
|---|---|
| PubChem CID | 142880322 |
| Molecular Formula | C18H17FNO6+ |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [4-(4-fluoro-2-nitrophenyl)-2-methoxycarbonyl-3-phenylbutanoyl]oxidanium |
| SMILES | COC(=O)C(C(=O)[OH2+])C(Cc1ccc(F)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H16FNO6/c1-26-18(23)16(17(21)22)14(11-5-3-2-4-6-11)9-12-7-8-13(19)10-15(12)20(24)25/h2-8,10,14,16H,9H2,1H3,(H,21,22)/p+1 |
| InChIKey | YDFCSFKKLSWZJB-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|