C22H28FN3 — CID 142881597
4-[3-[4-[1-(4-fluorophenyl)ethylidene]piperidin-1-yl]propyl]benzene-1,2-diamine (PubChem CID 142881597) has the molecular formula C22H28FN3 and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[3-[4-[1-(4-fluorophenyl)ethylidene]piperidin-1-yl]propyl]benzene-1,2-diamine.
| Compound Name | 4-[3-[4-[1-(4-fluorophenyl)ethylidene]piperidin-1-yl]propyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 142881597 |
| Molecular Formula | C22H28FN3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 4-[3-[4-[1-(4-fluorophenyl)ethylidene]piperidin-1-yl]propyl]benzene-1,2-diamine |
| SMILES | CC(=C1CCN(CCCc2ccc(N)c(N)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN3/c1-16(18-5-7-20(23)8-6-18)19-10-13-26(14-11-19)12-2-3-17-4-9-21(24)22(25)15-17/h4-9,15H,2-3,10-14,24-25H2,1H3 |
| InChIKey | GHBCVWYSLWAUKO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|