C21H27FN2S — CID 22622561
4-[4-[(4-fluorophenyl)-(4-methylthiophen-2-yl)methylidene]piperidin-1-yl]butan-1-amine (PubChem CID 22622561) has the molecular formula C21H27FN2S and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)-(4-methylthiophen-2-yl)methylidene]piperidin-1-yl]butan-1-amine.
| Compound Name | 4-[4-[(4-fluorophenyl)-(4-methylthiophen-2-yl)methylidene]piperidin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 22622561 |
| Molecular Formula | C21H27FN2S |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)-(4-methylthiophen-2-yl)methylidene]piperidin-1-yl]butan-1-amine |
| SMILES | Cc1csc(C(=C2CCN(CCCCN)CC2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H27FN2S/c1-16-14-20(25-15-16)21(17-4-6-19(22)7-5-17)18-8-12-24(13-9-18)11-3-2-10-23/h4-7,14-15H,2-3,8-13,23H2,1H3 |
| InChIKey | GQSQBPSBFQJCAR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|