C23H28ClN — CID 21478599
4-[bis(4-methylphenyl)methylidene]-1-(3-chloropropyl)piperidine (PubChem CID 21478599) has the molecular formula C23H28ClN and a molecular weight of 353.94 g/mol. Its IUPAC name is 4-[bis(4-methylphenyl)methylidene]-1-(3-chloropropyl)piperidine.
| Compound Name | 4-[bis(4-methylphenyl)methylidene]-1-(3-chloropropyl)piperidine |
|---|---|
| PubChem CID | 21478599 |
| Molecular Formula | C23H28ClN |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-[bis(4-methylphenyl)methylidene]-1-(3-chloropropyl)piperidine |
| SMILES | Cc1ccc(C(=C2CCN(CCCCl)CC2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H28ClN/c1-18-4-8-20(9-5-18)23(21-10-6-19(2)7-11-21)22-12-16-25(17-13-22)15-3-14-24/h4-11H,3,12-17H2,1-2H3 |
| InChIKey | XLLCYPNDRROHKQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|