C28H29NO — CID 23383814
1-[4-[[1-[(4-methylphenyl)methyl]piperidin-4-ylidene]-phenylmethyl]phenyl]ethanone (PubChem CID 23383814) has the molecular formula C28H29NO and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-[4-[[1-[(4-methylphenyl)methyl]piperidin-4-ylidene]-phenylmethyl]phenyl]ethanone.
| Compound Name | 1-[4-[[1-[(4-methylphenyl)methyl]piperidin-4-ylidene]-phenylmethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 23383814 |
| Molecular Formula | C28H29NO |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[4-[[1-[(4-methylphenyl)methyl]piperidin-4-ylidene]-phenylmethyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C(=C2CCN(Cc3ccc(C)cc3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29NO/c1-21-8-10-23(11-9-21)20-29-18-16-27(17-19-29)28(25-6-4-3-5-7-25)26-14-12-24(13-15-26)22(2)30/h3-15H,16-20H2,1-2H3 |
| InChIKey | UQCBAXJVKMMPSF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |