C26H44O5 — CID 142882347
(3R)-5-[(2E)-2-[1-[1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexane-1,2,3-triol (PubChem CID 142882347) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is (3R)-5-[(2E)-2-[1-[1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexane-1,2,3-triol.
| Compound Name | (3R)-5-[(2E)-2-[1-[1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 142882347 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | (3R)-5-[(2E)-2-[1-[1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexane-1,2,3-triol |
| SMILES | CC(OCCC(C)(C)O)C1CCC2/C(=C/C=C3/CC(O)C(C)(O)[C@H](O)C3)CCCC21C |
| InChI | InChI=1S/C26H44O5/c1-17(31-14-13-24(2,3)29)20-10-11-21-19(7-6-12-25(20,21)4)9-8-18-15-22(27)26(5,30)23(28)16-18/h8-9,17,20-23,27-30H,6-7,10-16H2,1-5H3/b18-8-,19-9+/t17?,20?,21?,22?,23-,25?,26?/m1/s1 |
| InChIKey | OPRPRWWONUWZKE-LOKHKLIRSA-N |
| XLogP | 3.89 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |