C27H44O3 — CID 75292687
6-[2-[7a-methyl-1-[1-(3-methylbutoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]spiro[2.5]octane-4,8-diol (PubChem CID 75292687) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is 6-[2-[7a-methyl-1-[1-(3-methylbutoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]spiro[2.5]octane-4,8-diol.
| Compound Name | 6-[2-[7a-methyl-1-[1-(3-methylbutoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]spiro[2.5]octane-4,8-diol |
|---|---|
| PubChem CID | 75292687 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 6-[2-[7a-methyl-1-[1-(3-methylbutoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]spiro[2.5]octane-4,8-diol |
| SMILES | CC(C)CCOC(C)C1CCC2C(=CC=C3CC(O)C4(CC4)C(O)C3)CCCC21C |
| InChI | InChI=1S/C27H44O3/c1-18(2)11-15-30-19(3)22-9-10-23-21(6-5-12-26(22,23)4)8-7-20-16-24(28)27(13-14-27)25(29)17-20/h7-8,18-19,22-25,28-29H,5-6,9-17H2,1-4H3 |
| InChIKey | JAQXIMAUIZKQRS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |