About methylcyclopropane;(3-methylfuran-2-yl)methanamine
methylcyclopropane;(3-methylfuran-2-yl)methanamine (PubChem CID 142883661) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is methylcyclopropane;(3-methylfuran-2-yl)methanamine.
Molecular Properties
| Compound Name | methylcyclopropane;(3-methylfuran-2-yl)methanamine |
| PubChem CID | 142883661 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | methylcyclopropane;(3-methylfuran-2-yl)methanamine |
| SMILES | CC1CC1.Cc1ccoc1CN |
| InChI | InChI=1S/C6H9NO.C4H8/c1-5-2-3-8-6(5)4-7;1-4-2-3-4/h2-3H,4,7H2,1H3;4H,2-3H2,1H3 |
| InChIKey | IFRHSEMYDOQHOT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methylcyclopropane;(3-methylfuran-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclopropane;(3-methylfuran-2-yl)methanamine?
The IUPAC name of methylcyclopropane;(3-methylfuran-2-yl)methanamine (CID 142883661) is methylcyclopropane;(3-methylfuran-2-yl)methanamine.
What is the SMILES notation for methylcyclopropane;(3-methylfuran-2-yl)methanamine?
The canonical SMILES for methylcyclopropane;(3-methylfuran-2-yl)methanamine is CC1CC1.Cc1ccoc1CN.
What is the InChIKey of methylcyclopropane;(3-methylfuran-2-yl)methanamine?
The InChIKey is IFRHSEMYDOQHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H8/c1-5-2-3-8-6(5)4-7;1-4-2-3-4/h2-3H,4,7H2,1H3;4H,2-3H2,1H3.
What are the key properties of methylcyclopropane;(3-methylfuran-2-yl)methanamine?
methylcyclopropane;(3-methylfuran-2-yl)methanamine has a molecular weight of 167.25 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclopropane;(3-methylfuran-2-yl)methanamine is sourced from PubChem (CID 142883661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).