About 2-ethyl-3-methylfuran;methane
2-ethyl-3-methylfuran;methane (PubChem CID 160795170) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethyl-3-methylfuran;methane.
Molecular Properties
| Compound Name | 2-ethyl-3-methylfuran;methane |
| PubChem CID | 160795170 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 2-ethyl-3-methylfuran;methane |
| SMILES | C.CCc1occc1C |
| InChI | InChI=1S/C7H10O.CH4/c1-3-7-6(2)4-5-8-7;/h4-5H,3H2,1-2H3;1H4 |
| InChIKey | SCIQCGQKOBAPAA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-3-methylfuran;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methylfuran;methane?
The IUPAC name of 2-ethyl-3-methylfuran;methane (CID 160795170) is 2-ethyl-3-methylfuran;methane.
What is the SMILES notation for 2-ethyl-3-methylfuran;methane?
The canonical SMILES for 2-ethyl-3-methylfuran;methane is C.CCc1occc1C.
What is the InChIKey of 2-ethyl-3-methylfuran;methane?
The InChIKey is SCIQCGQKOBAPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.CH4/c1-3-7-6(2)4-5-8-7;/h4-5H,3H2,1-2H3;1H4.
What are the key properties of 2-ethyl-3-methylfuran;methane?
2-ethyl-3-methylfuran;methane has a molecular weight of 126.20 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methylfuran;methane is sourced from PubChem (CID 160795170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).