C11H17NO — CID 142883688
(3Z,5E)-7-amino-4-ethenylnona-1,3,5-trien-3-ol (PubChem CID 142883688) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3Z,5E)-7-amino-4-ethenylnona-1,3,5-trien-3-ol.
| Compound Name | (3Z,5E)-7-amino-4-ethenylnona-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 142883688 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3Z,5E)-7-amino-4-ethenylnona-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(C=C)/C=C/C(N)CC |
| InChI | InChI=1S/C11H17NO/c1-4-9(11(13)6-3)7-8-10(12)5-2/h4,6-8,10,13H,1,3,5,12H2,2H3/b8-7+,11-9- |
| InChIKey | MQAQESPKCANBKP-OHFYBLQUSA-N |
| XLogP | 2.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|