C23H31ClN2O3S2 — CID 142885448
N-[3-[(2E,4Z,6E)-6-chloro-1-hydroxy-2-methylocta-2,4,6-trienyl]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]-2-(3-hydroxypiperidin-1-yl)acetamide (PubChem CID 142885448) has the molecular formula C23H31ClN2O3S2 and a molecular weight of 483.10 g/mol. Its IUPAC name is N-[3-[(2E,4Z,6E)-6-chloro-1-hydroxy-2-methylocta-2,4,6-trienyl]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]-2-(3-hydroxypiperidin-1-yl)acetamide.
| Compound Name | N-[3-[(2E,4Z,6E)-6-chloro-1-hydroxy-2-methylocta-2,4,6-trienyl]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]-2-(3-hydroxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 142885448 |
| Molecular Formula | C23H31ClN2O3S2 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-[3-[(2E,4Z,6E)-6-chloro-1-hydroxy-2-methylocta-2,4,6-trienyl]-5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-yl]-2-(3-hydroxypiperidin-1-yl)acetamide |
| SMILES | C/C=C(Cl)\C=C/C=C(\C)C(O)c1c(NC(=O)CN2CCCC(O)C2)sc2c1CCSC2 |
| InChI | InChI=1S/C23H31ClN2O3S2/c1-3-16(24)7-4-6-15(2)22(29)21-18-9-11-30-14-19(18)31-23(21)25-20(28)13-26-10-5-8-17(27)12-26/h3-4,6-7,17,22,27,29H,5,8-14H2,1-2H3,(H,25,28)/b7-4-,15-6+,16-3+ |
| InChIKey | WLIJTZKKHZNOMS-UJIXIGRLSA-N |
| XLogP | 4.61 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|