C26H29FN4O4S — CID 142886053
6-[[(4-fluorophenyl)methylamino]-(3-oxo-3-piperazin-1-ylpropyl)sulfanylmethyl]-8-hydroxy-5-methoxyquinoline-7-carbaldehyde (PubChem CID 142886053) has the molecular formula C26H29FN4O4S and a molecular weight of 512.61 g/mol. Its IUPAC name is 6-[[(4-fluorophenyl)methylamino]-(3-oxo-3-piperazin-1-ylpropyl)sulfanylmethyl]-8-hydroxy-5-methoxyquinoline-7-carbaldehyde.
| Compound Name | 6-[[(4-fluorophenyl)methylamino]-(3-oxo-3-piperazin-1-ylpropyl)sulfanylmethyl]-8-hydroxy-5-methoxyquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 142886053 |
| Molecular Formula | C26H29FN4O4S |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 6-[[(4-fluorophenyl)methylamino]-(3-oxo-3-piperazin-1-ylpropyl)sulfanylmethyl]-8-hydroxy-5-methoxyquinoline-7-carbaldehyde |
| SMILES | COc1c(C(NCc2ccc(F)cc2)SCCC(=O)N2CCNCC2)c(C=O)c(O)c2ncccc12 |
| InChI | InChI=1S/C26H29FN4O4S/c1-35-25-19-3-2-9-29-23(19)24(34)20(16-32)22(25)26(30-15-17-4-6-18(27)7-5-17)36-14-8-21(33)31-12-10-28-11-13-31/h2-7,9,16,26,28,30,34H,8,10-15H2,1H3 |
| InChIKey | YIVWADKLDPOOFX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|