C12H16FNOSn — CID 142886129
[4-(4,4-dimethyl-1,3-oxazinan-2-yl)phenyl]-fluorotin (PubChem CID 142886129) has the molecular formula C12H16FNOSn and a molecular weight of 327.98 g/mol. Its IUPAC name is [4-(4,4-dimethyl-1,3-oxazinan-2-yl)phenyl]-fluorotin.
| Compound Name | [4-(4,4-dimethyl-1,3-oxazinan-2-yl)phenyl]-fluorotin |
|---|---|
| PubChem CID | 142886129 |
| Molecular Formula | C12H16FNOSn |
| Molecular Weight | 327.98 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | [4-(4,4-dimethyl-1,3-oxazinan-2-yl)phenyl]-fluorotin |
| SMILES | CC1(C)CCOC(c2ccc([Sn]F)cc2)N1 |
| InChI | InChI=1S/C12H16NO.FH.Sn/c1-12(2)8-9-14-11(13-12)10-6-4-3-5-7-10;;/h4-7,11,13H,8-9H2,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | JRXYBWJTGDCDCZ-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.98 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |